MELAMPODIN B ACETATE
TL;DR: MELAMPODIN B ACETATE (CAS 51212-98-7) is a chemical compound with molecular formula C19H20O8 and molecular weight 376.12 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
(11-acetyloxy-3-methylidene-4,13-dioxo-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-7,12(15)-dien-8-yl)methyl acetate
Also Known As: MELAMPODIN B ACETATE, NCI60_002539
| Molecular Formula | C19H20O8 |
|---|---|
| Molecular Weight | 376.12 g/mol |
| LogP | 0.6 |
| Topological Polar Surface Area | 105.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Exact Mass | 376.1158 |
| Heavy Atoms | 27 |
| Complexity | 775.0 |
Chemical Identifiers
| CAS Number | 51212-98-7 |
|---|---|
| SMILES | CC(=O)OCC1=CC2C(C3C=C(C(CC1)OC(=O)C)C(=O)O3)C(=C)C(=O)O2 |
| InChIKey | OGRMZEFFIFTCNB-UHFFFAOYSA-N |
Product Overview
MELAMPODIN B ACETATE (CAS 51212-98-7), with molecular formula C19H20O8 and molecular weight 376.12 g/mol. IUPAC: (11-acetyloxy-3-methylidene-4,13-dioxo-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-7,12(15)-dien-8-yl)methyl acetate.
Chemical Property Profile of MELAMPODIN B ACETATE
Property Insights of MELAMPODIN B ACETATE
The XLogP value of 0.6 suggests moderate lipophilicity, balancing water solubility and membrane permeability for MELAMPODIN B ACETATE. The TPSA of 105.0 Ų falls within the moderate polarity range, balancing permeability and solubility for MELAMPODIN B ACETATE. Following Lipinski's Rule of Five, MELAMPODIN B ACETATE has 0 hydrogen bond donor(s) and 8 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of MELAMPODIN B ACETATE?
The CAS number of MELAMPODIN B ACETATE is 51212-98-7.
What is the molecular formula of MELAMPODIN B ACETATE?
The molecular formula of MELAMPODIN B ACETATE is C19H20O8.
What is the molecular weight of MELAMPODIN B ACETATE?
The molecular weight of MELAMPODIN B ACETATE is 376.12 g/mol.
Where can I buy MELAMPODIN B ACETATE?
You can request a quote for MELAMPODIN B ACETATE directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for MELAMPODIN B ACETATE?
Yes, KEHONG BIO provides custom synthesis services for MELAMPODIN B ACETATE and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.