Desferrioxamine B mesylate
TL;DR: Desferrioxamine B mesylate (CAS 5115-09-3) is a chemical compound with molecular formula C27H54N6O10S and molecular weight 654.36 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
N-[5-[[4-[5-[acetyl(methyl)amino]pentylamino]-4-oxobutanoyl]-hydroxyamino]pentyl]-N'-(5-aminopentyl)-N'-hydroxybutanediamide;methanesulfonic acid
Also Known As: Desferrioxamine B mesylate, Desferrioxamine methanesulfonate, Desferrioxamine B methanesulfonate, n'-{5-[acetyl(methyl)amino]pentyl}-n-[5-({4-[(5-aminopentyl)(hydroxy)amino]-4-oxobutanoyl}amino)pentyl]-n-hydroxybutanediamide methanesulfonate(1:1), Propionohydroxamic acid, N-(5-(3-((5-aminopentyl)hydroxycarbamoyl)propionamido)pentyl)-3-((5-(N-hydroxyacetamido)pentyl)carbamoyl)-, methanesulfonate (salt)
| Molecular Formula | C27H54N6O10S |
|---|---|
| Molecular Weight | 654.36 g/mol |
| LogP | 0.67 |
| Topological Polar Surface Area | 248.0 Ų |
| Hydrogen Bond Donors | 6 |
| Hydrogen Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Exact Mass | 654.3622 |
| Heavy Atoms | 44 |
| Complexity | 830.0 |
Chemical Identifiers
| CAS Number | 5115-09-3 |
|---|---|
| SMILES | CC(=O)N(C)CCCCCNC(=O)CCC(=O)N(CCCCCNC(=O)CCC(=O)N(CCCCCN)O)O.CS(=O)(=O)O |
| InChIKey | RKYZLMFFFVLCSW-UHFFFAOYSA-N |
Product Overview
Desferrioxamine B mesylate (CAS 5115-09-3), with molecular formula C27H54N6O10S and molecular weight 654.36 g/mol. IUPAC: N-[5-[[4-[5-[acetyl(methyl)amino]pentylamino]-4-oxobutanoyl]-hydroxyamino]pentyl]-N'-(5-aminopentyl)-N'-hydroxybutanediamide;methanesulfonic acid.
Chemical Property Profile of Desferrioxamine B mesylate
Property Insights of Desferrioxamine B mesylate
The XLogP value of 0.67 suggests moderate lipophilicity, balancing water solubility and membrane permeability for Desferrioxamine B mesylate. The TPSA of 248.0 Ų indicates high polarity, suggesting Desferrioxamine B mesylate may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Desferrioxamine B mesylate has 6 hydrogen bond donor(s) and 11 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Desferrioxamine B mesylate?
The CAS number of Desferrioxamine B mesylate is 5115-09-3.
What is the molecular formula of Desferrioxamine B mesylate?
The molecular formula of Desferrioxamine B mesylate is C27H54N6O10S.
What is the molecular weight of Desferrioxamine B mesylate?
The molecular weight of Desferrioxamine B mesylate is 654.36 g/mol.
Where can I buy Desferrioxamine B mesylate?
You can request a quote for Desferrioxamine B mesylate directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Desferrioxamine B mesylate?
Yes, KEHONG BIO provides custom synthesis services for Desferrioxamine B mesylate and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.