Flupentixol EP Impurity B (E and Z Mixture) HCl
TL;DR: Flupentixol EP Impurity B (E and Z Mixture) HCl (CAS 47346-96-3) is a chemical compound with molecular formula C19H19ClF3NS and molecular weight 385.09 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
N,N-dimethyl-3-[2-(trifluoromethyl)thioxanthen-9-ylidene]propan-1-amine;hydrochloride
Also Known As: Flupentixol EP Impurity B (E and Z Mixture) HCl, (3Z)-N,N-dimethyl-3-[2-(trifluoromethyl)thioxanthen-9-ylidene]propan-1-amine hydrochloride
| Molecular Formula | C19H19ClF3NS |
|---|---|
| Molecular Weight | 385.09 g/mol |
| LogP | 5.9752 |
| Topological Polar Surface Area | 28.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Exact Mass | 385.0879 |
| Heavy Atoms | 25 |
| Complexity | 460.0 |
Chemical Identifiers
| CAS Number | 47346-96-3 |
|---|---|
| SMILES | CN(C)CCC=C1C2=CC=CC=C2SC3=C1C=C(C=C3)C(F)(F)F.Cl |
| InChIKey | KAKFVUQHGXFCIM-UHFFFAOYSA-N |
Product Overview
Flupentixol EP Impurity B (E and Z Mixture) HCl (CAS 47346-96-3), with molecular formula C19H19ClF3NS and molecular weight 385.09 g/mol. IUPAC: N,N-dimethyl-3-[2-(trifluoromethyl)thioxanthen-9-ylidene]propan-1-amine;hydrochloride.
Chemical Property Profile of Flupentixol EP Impurity B (E and Z Mixture) HCl
Property Insights of Flupentixol EP Impurity B (E and Z Mixture) HCl
The XLogP value of 5.9752 indicates that Flupentixol EP Impurity B (E and Z Mixture) HCl is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 28.5 Ų, Flupentixol EP Impurity B (E and Z Mixture) HCl exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, Flupentixol EP Impurity B (E and Z Mixture) HCl has 1 hydrogen bond donor(s) and 5 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Flupentixol EP Impurity B (E and Z Mixture) HCl?
The CAS number of Flupentixol EP Impurity B (E and Z Mixture) HCl is 47346-96-3.
What is the molecular formula of Flupentixol EP Impurity B (E and Z Mixture) HCl?
The molecular formula of Flupentixol EP Impurity B (E and Z Mixture) HCl is C19H19ClF3NS.
What is the molecular weight of Flupentixol EP Impurity B (E and Z Mixture) HCl?
The molecular weight of Flupentixol EP Impurity B (E and Z Mixture) HCl is 385.09 g/mol.
Where can I buy Flupentixol EP Impurity B (E and Z Mixture) HCl?
You can request a quote for Flupentixol EP Impurity B (E and Z Mixture) HCl directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Flupentixol EP Impurity B (E and Z Mixture) HCl?
Yes, KEHONG BIO provides custom synthesis services for Flupentixol EP Impurity B (E and Z Mixture) HCl and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.