Bullatine B
TL;DR: Bullatine B (CAS 466-26-2) is a chemical compound with molecular formula C24H39NO6 and molecular weight 437.28 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
11-ethyl-6,18-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8,16-triol
Also Known As: Neoline, Bullatine B, Dideacetyldelphisine, Bullatine-B, Xuan-Wu 3
| Molecular Formula | C24H39NO6 |
|---|---|
| Molecular Weight | 437.28 g/mol |
| LogP | -0.1 |
| Topological Polar Surface Area | 91.6 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Exact Mass | 437.27774 |
| Heavy Atoms | 31 |
| Complexity | 752.0 |
Chemical Identifiers
| CAS Number | 466-26-2 |
|---|---|
| SMILES | CCN1CC2(CCC(C34C2C(C(C31)C5(CC(C6CC4C5C6O)OC)O)OC)O)COC |
| InChIKey | XRARAKHBJHWUHW-UHFFFAOYSA-N |
Product Overview
Bullatine B (CAS 466-26-2), with molecular formula C24H39NO6 and molecular weight 437.28 g/mol. IUPAC: 11-ethyl-6,18-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8,16-triol.
Chemical Property Profile of Bullatine B
Property Insights of Bullatine B
The XLogP value of -0.1 indicates that Bullatine B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 91.6 Ų falls within the moderate polarity range, balancing permeability and solubility for Bullatine B. Following Lipinski's Rule of Five, Bullatine B has 3 hydrogen bond donor(s) and 7 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Bullatine B?
The CAS number of Bullatine B is 466-26-2.
What is the molecular formula of Bullatine B?
The molecular formula of Bullatine B is C24H39NO6.
What is the molecular weight of Bullatine B?
The molecular weight of Bullatine B is 437.28 g/mol.
Where can I buy Bullatine B?
You can request a quote for Bullatine B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Bullatine B?
Yes, KEHONG BIO provides custom synthesis services for Bullatine B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.