Rifamycin B dibutylethylhydrazide
TL;DR: Rifamycin B dibutylethylhydrazide (CAS 38123-28-3) is a chemical compound with molecular formula C49H71N3O13 and molecular weight 909.50 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
[27-[2-[(dibutylamino)-ethylamino]-2-oxoethoxy]-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-13-yl] acetate
Also Known As: Rifamycin B dibutylethylhydrazide, Acetic acid((1,2-dihydro-5,6,17,19,21-pentahydroxy-23-methoxy-2,4,12,16,18,20,22-heptamethyl-1,11-dioxo-2,7-(epoxypentadeca(1,11,13)trienimino)naphtho[2,1-b]furan-9-yl)oxy)-,21-acetate,2,2-dibutyl-1-
| Molecular Formula | C49H71N3O13 |
|---|---|
| Molecular Weight | 909.50 g/mol |
| LogP | 7.9 |
| Topological Polar Surface Area | 214.0 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Exact Mass | 909.4987 |
| Heavy Atoms | 65 |
| Complexity | 1680.0 |
Chemical Identifiers
| CAS Number | 38123-28-3 |
|---|---|
| SMILES | CCCCN(CCCC)N(CC)C(=O)COC1=C2C3=C(C(=C1)NC(=O)C(=CC=CC(C(C(C(C(C(C(C(C=COC4(C(=O)C2=C(O4)C(=C3O)C)C)OC)C)OC(=O)C)C)O)C)O)C)C)O |
| InChIKey | IGGFRTRKZAPDSI-UHFFFAOYSA-N |
Product Overview
Rifamycin B dibutylethylhydrazide (CAS 38123-28-3), with molecular formula C49H71N3O13 and molecular weight 909.50 g/mol. IUPAC: [27-[2-[(dibutylamino)-ethylamino]-2-oxoethoxy]-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-13-yl] acetate.
Chemical Property Profile of Rifamycin B dibutylethylhydrazide
Property Insights of Rifamycin B dibutylethylhydrazide
The XLogP value of 7.9 indicates that Rifamycin B dibutylethylhydrazide is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 214.0 Ų indicates high polarity, suggesting Rifamycin B dibutylethylhydrazide may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Rifamycin B dibutylethylhydrazide has 5 hydrogen bond donor(s) and 14 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Rifamycin B dibutylethylhydrazide?
The CAS number of Rifamycin B dibutylethylhydrazide is 38123-28-3.
What is the molecular formula of Rifamycin B dibutylethylhydrazide?
The molecular formula of Rifamycin B dibutylethylhydrazide is C49H71N3O13.
What is the molecular weight of Rifamycin B dibutylethylhydrazide?
The molecular weight of Rifamycin B dibutylethylhydrazide is 909.50 g/mol.
Where can I buy Rifamycin B dibutylethylhydrazide?
You can request a quote for Rifamycin B dibutylethylhydrazide directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Rifamycin B dibutylethylhydrazide?
Yes, KEHONG BIO provides custom synthesis services for Rifamycin B dibutylethylhydrazide and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.