Rifamycin B 2,5-dimethylpyrrolidide
TL;DR: Rifamycin B 2,5-dimethylpyrrolidide (CAS 38123-17-0) is a chemical compound with molecular formula C45H60N2O13 and molecular weight 836.41 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
[(9E,19E,21E)-27-[2-(2,5-dimethylpyrrolidin-1-yl)-2-oxoethoxy]-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-13-yl] acetate
Also Known As: Rifamycin B 2,5-dimethylpyrrolidide, NCI 143-439, Rifamycin, 4-O-(2-(2,5-dimethyl-1-pyrrolidinyl)-2-oxoethyl)-, Rifamycin, 4-O-[2-(2,5-dimethyl-1-pyrrolidinyl)-2-oxoethyl]-, [[2-(2,5-dimethylpyrrolidin-1-yl)-2-oxo-ethoxy]-tetrahydroxy-methoxy-heptamethyl-dioxo-[?]yl] acetate
| Molecular Formula | C45H60N2O13 |
|---|---|
| Molecular Weight | 836.41 g/mol |
| LogP | 5.82672 |
| Topological Polar Surface Area | 210.62 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Exact Mass | 836.40955 |
| Heavy Atoms | 60 |
| Complexity | 2084.098 |
Chemical Identifiers
| CAS Number | 38123-17-0 |
|---|---|
| SMILES | CC1CCC(N1C(=O)COC2=C3C4=C(C(=C2)NC(=O)/C(=C/C=C/C(C(C(C(C(C(C(C(/C=C/OC5(C(=O)C3=C(O5)C(=C4O)C)C)OC)C)OC(=O)C)C)O)C)O)C)/C)O)C |
Product Overview
Rifamycin B 2,5-dimethylpyrrolidide (CAS 38123-17-0), with molecular formula C45H60N2O13 and molecular weight 836.41 g/mol. IUPAC: [(9E,19E,21E)-27-[2-(2,5-dimethylpyrrolidin-1-yl)-2-oxoethoxy]-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-13-yl] acetate.
Chemical Property Profile of Rifamycin B 2,5-dimethylpyrrolidide
Property Insights of Rifamycin B 2,5-dimethylpyrrolidide
The XLogP value of 5.82672 indicates that Rifamycin B 2,5-dimethylpyrrolidide is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 210.62 Ų indicates high polarity, suggesting Rifamycin B 2,5-dimethylpyrrolidide may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Rifamycin B 2,5-dimethylpyrrolidide has 5 hydrogen bond donor(s) and 13 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Rifamycin B 2,5-dimethylpyrrolidide?
The CAS number of Rifamycin B 2,5-dimethylpyrrolidide is 38123-17-0.
What is the molecular formula of Rifamycin B 2,5-dimethylpyrrolidide?
The molecular formula of Rifamycin B 2,5-dimethylpyrrolidide is C45H60N2O13.
What is the molecular weight of Rifamycin B 2,5-dimethylpyrrolidide?
The molecular weight of Rifamycin B 2,5-dimethylpyrrolidide is 836.41 g/mol.
Where can I buy Rifamycin B 2,5-dimethylpyrrolidide?
You can request a quote for Rifamycin B 2,5-dimethylpyrrolidide directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Rifamycin B 2,5-dimethylpyrrolidide?
Yes, KEHONG BIO provides custom synthesis services for Rifamycin B 2,5-dimethylpyrrolidide and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.