(RS)-Indenestrol B
TL;DR: (RS)-Indenestrol B (CAS 38028-27-2) is a chemical compound with molecular formula C18H18O2 and molecular weight 266.13 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
1-ethyl-2-(4-hydroxyphenyl)-3-methyl-1H-inden-5-ol
Also Known As: Indenestrol B, Indenoestrol B, (-)-Indenestrol B, (RS)-INDENESTROL B, (+/-)-INDENESTROL B
| Molecular Formula | C18H18O2 |
|---|---|
| Molecular Weight | 266.13 g/mol |
| LogP | 4.0 |
| Topological Polar Surface Area | 40.5 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 266.13068 |
| Heavy Atoms | 20 |
| Complexity | 379.0 |
Chemical Identifiers
| CAS Number | 38028-27-2 |
|---|---|
| SMILES | CCC1C2=C(C=C(C=C2)O)C(=C1C3=CC=C(C=C3)O)C |
| InChIKey | HJVFIQKBLPQQDY-UHFFFAOYSA-N |
Product Overview
(RS)-Indenestrol B (CAS 38028-27-2), with molecular formula C18H18O2 and molecular weight 266.13 g/mol. IUPAC: 1-ethyl-2-(4-hydroxyphenyl)-3-methyl-1H-inden-5-ol.
Chemical Property Profile of (RS)-Indenestrol B
Property Insights of (RS)-Indenestrol B
The XLogP value of 4.0 indicates that (RS)-Indenestrol B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 40.5 Ų, (RS)-Indenestrol B exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, (RS)-Indenestrol B has 2 hydrogen bond donor(s) and 2 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of (RS)-Indenestrol B?
The CAS number of (RS)-Indenestrol B is 38028-27-2.
What is the molecular formula of (RS)-Indenestrol B?
The molecular formula of (RS)-Indenestrol B is C18H18O2.
What is the molecular weight of (RS)-Indenestrol B?
The molecular weight of (RS)-Indenestrol B is 266.13 g/mol.
Where can I buy (RS)-Indenestrol B?
You can request a quote for (RS)-Indenestrol B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for (RS)-Indenestrol B?
Yes, KEHONG BIO provides custom synthesis services for (RS)-Indenestrol B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.