Amphotericin B Impurity 1(Amphotericin B Methyl Ester)
TL;DR: Amphotericin B Impurity 1(Amphotericin B Methyl Ester) (CAS 36148-89-7) is a chemical compound with molecular formula C48H75NO17 and molecular weight 937.50 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
methyl (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,33R,35S,36R,37S)-33-(4-amino-3,5-dihydroxy-6-methyloxan-2-yl)oxy-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylate
Also Known As: AMPHOTERICIN B METHYL ESTER, Amphotericin B Impurity 1(Amphotericin B Methyl Ester)
| Molecular Formula | C48H75NO17 |
|---|---|
| Molecular Weight | 937.50 g/mol |
| LogP | 2.6 |
| Topological Polar Surface Area | 309.0 Ų |
| Hydrogen Bond Donors | 11 |
| Hydrogen Bond Acceptors | 18 |
| Rotatable Bonds | 4 |
| Exact Mass | 937.5035 |
| Heavy Atoms | 66 |
| Complexity | 1680.0 |
Chemical Identifiers
| CAS Number | 36148-89-7 |
|---|---|
| SMILES | C[C@H]1C=CC=CC=CC=CC=CC=CC=C[C@@H](C[C@H]2[C@@H]([C@H](C[C@](O2)(C[C@H](C[C@H]([C@@H](CC[C@H](C[C@H](CC(=O)O[C@H]([C@@H]([C@@H]1O)C)C)O)O)O)O)O)O)O)C(=O)OC)OC3C(C(C(C(O3)C)O)N)O |
| InChIKey | UAZIZEMIKKIBCA-JQQIOMDCSA-N |
Product Overview
Amphotericin B Impurity 1(Amphotericin B Methyl Ester) (CAS 36148-89-7), with molecular formula C48H75NO17 and molecular weight 937.50 g/mol. IUPAC: methyl (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,33R,35S,36R,37S)-33-(4-amino-3,5-dihydroxy-6-methyloxan-2-yl)oxy-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylate.
Chemical Property Profile of Amphotericin B Impurity 1(Amphotericin B Methyl Ester)
Property Insights of Amphotericin B Impurity 1(Amphotericin B Methyl Ester)
The XLogP value of 2.6 suggests moderate lipophilicity, balancing water solubility and membrane permeability for Amphotericin B Impurity 1(Amphotericin B Methyl Ester). The TPSA of 309.0 Ų indicates high polarity, suggesting Amphotericin B Impurity 1(Amphotericin B Methyl Ester) may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Amphotericin B Impurity 1(Amphotericin B Methyl Ester) has 11 hydrogen bond donor(s) and 18 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Amphotericin B Impurity 1(Amphotericin B Methyl Ester)?
The CAS number of Amphotericin B Impurity 1(Amphotericin B Methyl Ester) is 36148-89-7.
What is the molecular formula of Amphotericin B Impurity 1(Amphotericin B Methyl Ester)?
The molecular formula of Amphotericin B Impurity 1(Amphotericin B Methyl Ester) is C48H75NO17.
What is the molecular weight of Amphotericin B Impurity 1(Amphotericin B Methyl Ester)?
The molecular weight of Amphotericin B Impurity 1(Amphotericin B Methyl Ester) is 937.50 g/mol.
Where can I buy Amphotericin B Impurity 1(Amphotericin B Methyl Ester)?
You can request a quote for Amphotericin B Impurity 1(Amphotericin B Methyl Ester) directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Amphotericin B Impurity 1(Amphotericin B Methyl Ester)?
Yes, KEHONG BIO provides custom synthesis services for Amphotericin B Impurity 1(Amphotericin B Methyl Ester) and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.