Tetraphyllin B: epitetraphyllin B (kcs-2CA)
TL;DR: Tetraphyllin B: epitetraphyllin B (kcs-2CA) (CAS 35464-56-3) is a chemical compound with molecular formula C12H17NO7 and molecular weight 287.10 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
4-hydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclopent-2-ene-1-carbonitrile
Also Known As: Tetraphyllin B, Barterin, (1S,4S)-Tetraphyllin B, KST-1B3485, TETRAPHYLLIN B: EPITETRAPHYLLIN B (KCS-2CA)
| Molecular Formula | C12H17NO7 |
|---|---|
| Molecular Weight | 287.10 g/mol |
| LogP | -2.3 |
| Topological Polar Surface Area | 143.0 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Exact Mass | 287.1005 |
| Heavy Atoms | 20 |
| Complexity | 433.0 |
| Melting Point | 169 - 170 °C |
Chemical Identifiers
| CAS Number | 35464-56-3 |
|---|---|
| SMILES | C1C(C=CC1(C#N)OC2C(C(C(C(O2)CO)O)O)O)O |
| InChIKey | JRCWYCAEAZEYNW-UHFFFAOYSA-N |
Product Overview
Tetraphyllin B: epitetraphyllin B (kcs-2CA) (CAS 35464-56-3), with molecular formula C12H17NO7 and molecular weight 287.10 g/mol. IUPAC: 4-hydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclopent-2-ene-1-carbonitrile.
Chemical Property Profile of Tetraphyllin B: epitetraphyllin B (kcs-2CA)
Property Insights of Tetraphyllin B: epitetraphyllin B (kcs-2CA)
The XLogP value of -2.3 indicates that Tetraphyllin B: epitetraphyllin B (kcs-2CA) is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 143.0 Ų indicates high polarity, suggesting Tetraphyllin B: epitetraphyllin B (kcs-2CA) may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Tetraphyllin B: epitetraphyllin B (kcs-2CA) has 5 hydrogen bond donor(s) and 8 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Tetraphyllin B: epitetraphyllin B (kcs-2CA)?
The CAS number of Tetraphyllin B: epitetraphyllin B (kcs-2CA) is 35464-56-3.
What is the molecular formula of Tetraphyllin B: epitetraphyllin B (kcs-2CA)?
The molecular formula of Tetraphyllin B: epitetraphyllin B (kcs-2CA) is C12H17NO7.
What is the molecular weight of Tetraphyllin B: epitetraphyllin B (kcs-2CA)?
The molecular weight of Tetraphyllin B: epitetraphyllin B (kcs-2CA) is 287.10 g/mol.
Where can I buy Tetraphyllin B: epitetraphyllin B (kcs-2CA)?
You can request a quote for Tetraphyllin B: epitetraphyllin B (kcs-2CA) directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Tetraphyllin B: epitetraphyllin B (kcs-2CA)?
Yes, KEHONG BIO provides custom synthesis services for Tetraphyllin B: epitetraphyllin B (kcs-2CA) and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.