Pterosin B
TL;DR: Pterosin B (CAS 34175-96-7) is a chemical compound with molecular formula C14H18O2 and molecular weight 218.13 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
(2R)-6-(2-hydroxyethyl)-2,5,7-trimethyl-2,3-dihydroinden-1-one
Also Known As: Pterosin B, (2R)-Pterosin B, PterosinB, Multifidoside B, hydrogen dithionite
| Molecular Formula | C14H18O2 |
|---|---|
| Molecular Weight | 218.13 g/mol |
| LogP | 2.5 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 218.13068 |
| Heavy Atoms | 16 |
| Complexity | 274.0 |
Chemical Identifiers
| CAS Number | 34175-96-7 |
|---|---|
| SMILES | C[C@@H]1CC2=C(C1=O)C(=C(C(=C2)C)CCO)C |
| InChIKey | SJNCSXMTBXDZQA-SECBINFHSA-N |
Product Overview
Pterosin B (CAS 34175-96-7), with molecular formula C14H18O2 and molecular weight 218.13 g/mol. IUPAC: (2R)-6-(2-hydroxyethyl)-2,5,7-trimethyl-2,3-dihydroinden-1-one.
Chemical Property Profile of Pterosin B
Property Insights of Pterosin B
The XLogP value of 2.5 suggests moderate lipophilicity, balancing water solubility and membrane permeability for Pterosin B. With a topological polar surface area (TPSA) of 37.3 Ų, Pterosin B exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, Pterosin B has 1 hydrogen bond donor(s) and 2 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Pterosin B?
The CAS number of Pterosin B is 34175-96-7.
What is the molecular formula of Pterosin B?
The molecular formula of Pterosin B is C14H18O2.
What is the molecular weight of Pterosin B?
The molecular weight of Pterosin B is 218.13 g/mol.
Where can I buy Pterosin B?
You can request a quote for Pterosin B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Pterosin B?
Yes, KEHONG BIO provides custom synthesis services for Pterosin B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.