BAS 01403155
TL;DR: BAS 01403155 (CAS 337923-04-3) is a chemical compound with molecular formula C23H18N2O4 and molecular weight 386.13 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
(4E)-5-(4-hydroxyphenyl)-4-[hydroxy(phenyl)methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione
Also Known As: BAS 01403155, 4-benzoyl-3-hydroxy-5-(4-hydroxyphenyl)-1-(pyridin-3-ylmethyl)-1H-pyrrol-2(5H)-one, 3-hydroxy-5-(4-hydroxyphenyl)-4-(phenylcarbonyl)-1-(3-pyridylmethyl)-3-pyrroli n-2-one, (4E)-5-(4-hydroxyphenyl)-4-[hydroxy(phenyl)methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione, 3-hydroxy-5-(4-hydroxyphenyl)-4-(phenylcarbonyl)-1-(pyridin-3-ylmethyl)-1,5-dihydro-2H-pyrrol-2-one
| Molecular Formula | C23H18N2O4 |
|---|---|
| Molecular Weight | 386.13 g/mol |
| LogP | 3.4091 |
| Topological Polar Surface Area | 90.73 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 386.12665 |
| Heavy Atoms | 29 |
| Complexity | 1076.8802 |
Chemical Identifiers
| CAS Number | 337923-04-3 |
|---|---|
| SMILES | C1=CC=C(C=C1)/C(=C\2/C(N(C(=O)C2=O)CC3=CN=CC=C3)C4=CC=C(C=C4)O)/O |
Product Overview
BAS 01403155 (CAS 337923-04-3), with molecular formula C23H18N2O4 and molecular weight 386.13 g/mol. IUPAC: (4E)-5-(4-hydroxyphenyl)-4-[hydroxy(phenyl)methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione.
Chemical Property Profile of BAS 01403155
Property Insights of BAS 01403155
The XLogP value of 3.4091 indicates that BAS 01403155 is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 90.73 Ų falls within the moderate polarity range, balancing permeability and solubility for BAS 01403155. Following Lipinski's Rule of Five, BAS 01403155 has 2 hydrogen bond donor(s) and 5 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of BAS 01403155?
The CAS number of BAS 01403155 is 337923-04-3.
What is the molecular formula of BAS 01403155?
The molecular formula of BAS 01403155 is C23H18N2O4.
What is the molecular weight of BAS 01403155?
The molecular weight of BAS 01403155 is 386.13 g/mol.
Where can I buy BAS 01403155?
You can request a quote for BAS 01403155 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for BAS 01403155?
Yes, KEHONG BIO provides custom synthesis services for BAS 01403155 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.