Azure B (11)
TL;DR: Azure B (11) (CAS 29260-45-5) is a chemical compound with molecular formula C15H16N3S+ and molecular weight 270.11 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
dimethyl-[7-(methylamino)phenothiazin-3-ylidene]azanium
Also Known As: azure B cation, Azure B, Azure B (11), azure B(1+), 3-(Dimethylamino)-7-(methylamino)phenothiazin-5-ium
| Molecular Formula | C15H16N3S+ |
|---|---|
| Molecular Weight | 270.11 g/mol |
| LogP | 2.1 |
| Topological Polar Surface Area | 52.7 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 270.1065 |
| Heavy Atoms | 19 |
| Complexity | 498.0 |
Chemical Identifiers
| CAS Number | 29260-45-5 |
|---|---|
| SMILES | CNC1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C=C3S2 |
| InChIKey | KKGWEPLBCABCDN-UHFFFAOYSA-O |
Product Overview
Azure B (11) (CAS 29260-45-5), with molecular formula C15H16N3S+ and molecular weight 270.11 g/mol. IUPAC: dimethyl-[7-(methylamino)phenothiazin-3-ylidene]azanium.
Chemical Property Profile of Azure B (11)
Property Insights of Azure B (11)
The XLogP value of 2.1 suggests moderate lipophilicity, balancing water solubility and membrane permeability for Azure B (11). With a topological polar surface area (TPSA) of 52.7 Ų, Azure B (11) exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, Azure B (11) has 1 hydrogen bond donor(s) and 3 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Azure B (11)?
The CAS number of Azure B (11) is 29260-45-5.
What is the molecular formula of Azure B (11)?
The molecular formula of Azure B (11) is C15H16N3S+.
What is the molecular weight of Azure B (11)?
The molecular weight of Azure B (11) is 270.11 g/mol.
Where can I buy Azure B (11)?
You can request a quote for Azure B (11) directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Azure B (11)?
Yes, KEHONG BIO provides custom synthesis services for Azure B (11) and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.