cytonic acid B
TL;DR: cytonic acid B (CAS 273738-58-2) is a chemical compound with molecular formula C32H36O10 and molecular weight 580.23 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
4-[4-(2,4-dihydroxy-6-propylbenzoyl)oxy-2-hydroxy-6-propylbenzoyl]oxy-2-hydroxy-6-pentylbenzoic acid
Also Known As: Cytonic acid B, J1.317.040A, 4-[4-(2,4-dihydroxy-6-propylbenzoyl)oxy-2-hydroxy-6-propylbenzoyl]oxy-2-hydroxy-6-pentylbenzoic acid, 4-({4-[(2,4-dihydroxy-6-propylbenzoyl)oxy]-2-hydroxy-6-propylbenzoyl}oxy)-2-hydroxy-6-pentylbenzoic acid, 2-Hydroxy-6-pentyl-4-[[2-hydroxy-6-propyl-4-[(2,4-dihydroxy-6-propylbenzoyl)oxy]benzoyl]oxy]benzoic acid
| Molecular Formula | C32H36O10 |
|---|---|
| Molecular Weight | 580.23 g/mol |
| LogP | 9.6 |
| Topological Polar Surface Area | 171.0 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Exact Mass | 580.23083 |
| Heavy Atoms | 42 |
| Complexity | 879.0 |
Chemical Identifiers
| CAS Number | 273738-58-2 |
|---|---|
| SMILES | CCCCCC1=C(C(=CC(=C1)OC(=O)C2=C(C=C(C=C2O)OC(=O)C3=C(C=C(C=C3O)O)CCC)CCC)O)C(=O)O |
| InChIKey | NUJLMXRQKUYQKE-UHFFFAOYSA-N |
Product Overview
cytonic acid B (CAS 273738-58-2), with molecular formula C32H36O10 and molecular weight 580.23 g/mol. IUPAC: 4-[4-(2,4-dihydroxy-6-propylbenzoyl)oxy-2-hydroxy-6-propylbenzoyl]oxy-2-hydroxy-6-pentylbenzoic acid.
Chemical Property Profile of cytonic acid B
Property Insights of cytonic acid B
The XLogP value of 9.6 indicates that cytonic acid B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 171.0 Ų indicates high polarity, suggesting cytonic acid B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, cytonic acid B has 5 hydrogen bond donor(s) and 10 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of cytonic acid B?
The CAS number of cytonic acid B is 273738-58-2.
What is the molecular formula of cytonic acid B?
The molecular formula of cytonic acid B is C32H36O10.
What is the molecular weight of cytonic acid B?
The molecular weight of cytonic acid B is 580.23 g/mol.
Where can I buy cytonic acid B?
You can request a quote for cytonic acid B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for cytonic acid B?
Yes, KEHONG BIO provides custom synthesis services for cytonic acid B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.