Alisol B 23-monoacetate
TL;DR: Alisol B 23-monoacetate (CAS 26575-95-1) is a chemical compound with molecular formula C32H50O5 and molecular weight 514.37 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
[1-(3,3-dimethyloxiran-2-yl)-3-[(8S,10S,11S,14R)-11-hydroxy-4,4,8,10,14-pentamethyl-3-oxo-1,2,5,6,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-17-yl]butyl] acetate
Also Known As: Alisolbacetate, Alisol B 23-acetate, Alisol B 23-monoacetate, 23-O-Acetylalisol B, Alisol B,23-acetate
| Molecular Formula | C32H50O5 |
|---|---|
| Molecular Weight | 514.37 g/mol |
| LogP | 6.4109 |
| Topological Polar Surface Area | 76.13 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Exact Mass | 514.36584 |
| Heavy Atoms | 37 |
| Complexity | 1024.1958 |
Chemical Identifiers
| CAS Number | 26575-95-1 |
|---|---|
| SMILES | CC(CC(C1C(O1)(C)C)OC(=O)C)C2=C3C[C@@H](C4[C@]5(CCC(=O)C(C5CC[C@@]4([C@]3(CC2)C)C)(C)C)C)O |
Product Overview
Alisol B 23-monoacetate (CAS 26575-95-1), with molecular formula C32H50O5 and molecular weight 514.37 g/mol. IUPAC: [1-(3,3-dimethyloxiran-2-yl)-3-[(8S,10S,11S,14R)-11-hydroxy-4,4,8,10,14-pentamethyl-3-oxo-1,2,5,6,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-17-yl]butyl] acetate.
Chemical Property Profile of Alisol B 23-monoacetate
Property Insights of Alisol B 23-monoacetate
The XLogP value of 6.4109 indicates that Alisol B 23-monoacetate is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 76.13 Ų falls within the moderate polarity range, balancing permeability and solubility for Alisol B 23-monoacetate. Following Lipinski's Rule of Five, Alisol B 23-monoacetate has 1 hydrogen bond donor(s) and 5 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Alisol B 23-monoacetate?
The CAS number of Alisol B 23-monoacetate is 26575-95-1.
What is the molecular formula of Alisol B 23-monoacetate?
The molecular formula of Alisol B 23-monoacetate is C32H50O5.
What is the molecular weight of Alisol B 23-monoacetate?
The molecular weight of Alisol B 23-monoacetate is 514.37 g/mol.
Where can I buy Alisol B 23-monoacetate?
You can request a quote for Alisol B 23-monoacetate directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Alisol B 23-monoacetate?
Yes, KEHONG BIO provides custom synthesis services for Alisol B 23-monoacetate and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.