B 9720
TL;DR: B 9720 (CAS 25901-35-3) is a chemical compound with molecular formula C29H30I6N4O8 and molecular weight 1323.63 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
B 9720
3-(acetamidomethyl)-5-[[9-[3-(acetamidomethyl)-5-carboxy-2,4,6-triiodoanilino]-9-oxononanoyl]amino]-2,4,6-triiodobenzoic acid
Also Known As: 3,3'-(Azelaoyldiimino)bis(5-(acetamidomethyl)-2,4,6-triiodobenzoic acid), m-Toluic acid, 5,5'-(azelaoyldiimino)bis(alpha-acetamido-2,4,6-triiodo-, BENZOIC ACID, 3,3'-(AZELAOYLDIIMINO)BIS(5-(ACETAMIDOMETHYL)-2,4,6-TRIIODO-, 3-(acetamidomethyl)-5-[[9-[3-(acetamidomethyl)-5-carboxy-2,4,6-triiodoanilino]-9-oxononanoyl]amino]-2,4,6-triiodobenzoic acid, Benzoic acid, 3,3'-((1,9-dioxo-1,9-nonanediyl)diimino)bis(5-((acetylamino)methyl)-2,4,6-triiodo-
| Molecular Formula | C29H30I6N4O8 |
|---|---|
| Molecular Weight | 1323.63 g/mol |
| LogP | 5.4 |
| Topological Polar Surface Area | 191.0 Ų |
| Hydrogen Bond Donors | 6 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Exact Mass | 1323.6332 |
| Heavy Atoms | 47 |
| Complexity | 1050.0 |
Chemical Identifiers
| CAS Number | 25901-35-3 |
|---|---|
| SMILES | CC(=O)NCC1=C(C(=C(C(=C1I)NC(=O)CCCCCCCC(=O)NC2=C(C(=C(C(=C2I)C(=O)O)I)CNC(=O)C)I)I)C(=O)O)I |
| InChIKey | AZQHFPSJBZBCNP-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
B 9720 (CAS 25901-35-3), with molecular formula C29H30I6N4O8 and molecular weight 1323.63 g/mol. IUPAC: 3-(acetamidomethyl)-5-[[9-[3-(acetamidomethyl)-5-carboxy-2,4,6-triiodoanilino]-9-oxononanoyl]amino]-2,4,6-triiodobenzoic acid.
Chemical Property Profile of B 9720
Property Insights of B 9720
The XLogP value of 5.4 indicates that B 9720 is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 191.0 Ų indicates high polarity, suggesting B 9720 may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, B 9720 has 6 hydrogen bond donor(s) and 8 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 9720?
The CAS number of B 9720 is 25901-35-3.
What is the molecular formula of B 9720?
The molecular formula of B 9720 is C29H30I6N4O8.
What is the molecular weight of B 9720?
The molecular weight of B 9720 is 1323.63 g/mol.
Where can I buy B 9720?
You can request a quote for B 9720 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 9720?
Yes, KEHONG BIO provides custom synthesis services for B 9720 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.