(+)-Conduritol B
TL;DR: (+)-Conduritol B (CAS 25348-64-5) is a chemical compound with molecular formula C6H10O4 and molecular weight 146.06 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
(1S,2R,3R,4S)-cyclohex-5-ene-1,2,3,4-tetrol
Also Known As: (+)-Conduritol B, Conduritol B, Conduritol B, (+)-, (+)-D-conduritol B, 5-Cyclohexene-1,2,3,4-tetrol
| Molecular Formula | C6H10O4 |
|---|---|
| Molecular Weight | 146.06 g/mol |
| LogP | -2.1 |
| Topological Polar Surface Area | 80.9 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 0 |
| Exact Mass | 146.0579 |
| Heavy Atoms | 10 |
| Complexity | 129.0 |
Chemical Identifiers
| CAS Number | 25348-64-5 |
|---|---|
| SMILES | C1=C[C@@H]([C@H]([C@@H]([C@H]1O)O)O)O |
| InChIKey | LRUBQXAKGXQBHA-UNTFVMJOSA-N |
Product Overview
(+)-Conduritol B (CAS 25348-64-5), with molecular formula C6H10O4 and molecular weight 146.06 g/mol. IUPAC: (1S,2R,3R,4S)-cyclohex-5-ene-1,2,3,4-tetrol.
Chemical Property Profile of (+)-Conduritol B
Property Insights of (+)-Conduritol B
The XLogP value of -2.1 indicates that (+)-Conduritol B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 80.9 Ų falls within the moderate polarity range, balancing permeability and solubility for (+)-Conduritol B. Following Lipinski's Rule of Five, (+)-Conduritol B has 4 hydrogen bond donor(s) and 4 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of (+)-Conduritol B?
The CAS number of (+)-Conduritol B is 25348-64-5.
What is the molecular formula of (+)-Conduritol B?
The molecular formula of (+)-Conduritol B is C6H10O4.
What is the molecular weight of (+)-Conduritol B?
The molecular weight of (+)-Conduritol B is 146.06 g/mol.
Where can I buy (+)-Conduritol B?
You can request a quote for (+)-Conduritol B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for (+)-Conduritol B?
Yes, KEHONG BIO provides custom synthesis services for (+)-Conduritol B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.