B 739
TL;DR: B 739 (CAS 25209-62-5) is a chemical compound with molecular formula C10H21Cl2N2O2P and molecular weight 302.07 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
N,N-bis(2-chloroethyl)-2-oxo-3-propyl-1,3,2λ5-oxazaphosphinan-2-amine
Also Known As: B 739, B-739, N,N-bis(2-chloroethyl)-2-oxo-3-propyl-1,3,2, Tetrahydro-2-(bis(2-chloroethyl)amino)-3-propyl-2H-1,3,2-oxazaphosphorine 2-oxide, 2H-1,3,2-Oxazaphosphorine, tetrahydro-2-(bis(2-chloroethyl)amino)-3-propyl-, 2-oxide
| Molecular Formula | C10H21Cl2N2O2P |
|---|---|
| Molecular Weight | 302.07 g/mol |
| LogP | 2.1 |
| Topological Polar Surface Area | 32.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Exact Mass | 302.07178 |
| Heavy Atoms | 17 |
| Complexity | 263.0 |
Chemical Identifiers
| CAS Number | 25209-62-5 |
|---|---|
| SMILES | CCCN1CCCOP1(=O)N(CCCl)CCCl |
| InChIKey | AHNZGDLSLKEBHU-UHFFFAOYSA-N |
Product Overview
B 739 (CAS 25209-62-5), with molecular formula C10H21Cl2N2O2P and molecular weight 302.07 g/mol. IUPAC: N,N-bis(2-chloroethyl)-2-oxo-3-propyl-1,3,2λ5-oxazaphosphinan-2-amine.
Chemical Property Profile of B 739
Property Insights of B 739
The XLogP value of 2.1 suggests moderate lipophilicity, balancing water solubility and membrane permeability for B 739. With a topological polar surface area (TPSA) of 32.8 Ų, B 739 exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, B 739 has 0 hydrogen bond donor(s) and 4 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 739?
The CAS number of B 739 is 25209-62-5.
What is the molecular formula of B 739?
The molecular formula of B 739 is C10H21Cl2N2O2P.
What is the molecular weight of B 739?
The molecular weight of B 739 is 302.07 g/mol.
Where can I buy B 739?
You can request a quote for B 739 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 739?
Yes, KEHONG BIO provides custom synthesis services for B 739 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.