Zirconium(IV) chloride tetrahydrofuran complex
TL;DR: Zirconium(IV) chloride tetrahydrofuran complex (CAS 21959-01-3) is a chemical compound with molecular formula C8H16Cl4O2Zr and molecular weight 373.90 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
oxolane;tetrachlorozirconium
Also Known As: Tetrachlorobis(tetrahydrofuran)zirconium, zrcl4(thf)2, oxolane;tetrachlorozirconium, ZrCl4(tetrahydrofuran)2, oxolane,tetrachlorozirconium
| Molecular Formula | C8H16Cl4O2Zr |
|---|---|
| Molecular Weight | 373.90 g/mol |
| LogP | 4.3491 |
| Topological Polar Surface Area | 18.46 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 0 |
| Exact Mass | 373.89514 |
| Heavy Atoms | 15 |
| Complexity | 103.874306 |
Chemical Identifiers
| CAS Number | 21959-01-3 |
|---|---|
| SMILES | C1CCOC1.C1CCOC1.Cl[Zr](Cl)(Cl)Cl |
Product Overview
Zirconium(IV) chloride tetrahydrofuran complex (CAS 21959-01-3), with molecular formula C8H16Cl4O2Zr and molecular weight 373.90 g/mol. IUPAC: oxolane;tetrachlorozirconium.
Chemical Property Profile of Zirconium(IV) chloride tetrahydrofuran complex
Property Insights of Zirconium(IV) chloride tetrahydrofuran complex
The XLogP value of 4.3491 indicates that Zirconium(IV) chloride tetrahydrofuran complex is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 18.46 Ų, Zirconium(IV) chloride tetrahydrofuran complex exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, Zirconium(IV) chloride tetrahydrofuran complex has 0 hydrogen bond donor(s) and 2 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Zirconium(IV) chloride tetrahydrofuran complex?
The CAS number of Zirconium(IV) chloride tetrahydrofuran complex is 21959-01-3.
What is the molecular formula of Zirconium(IV) chloride tetrahydrofuran complex?
The molecular formula of Zirconium(IV) chloride tetrahydrofuran complex is C8H16Cl4O2Zr.
What is the molecular weight of Zirconium(IV) chloride tetrahydrofuran complex?
The molecular weight of Zirconium(IV) chloride tetrahydrofuran complex is 373.90 g/mol.
Where can I buy Zirconium(IV) chloride tetrahydrofuran complex?
You can request a quote for Zirconium(IV) chloride tetrahydrofuran complex directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Zirconium(IV) chloride tetrahydrofuran complex?
Yes, KEHONG BIO provides custom synthesis services for Zirconium(IV) chloride tetrahydrofuran complex and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.