25-DA-rifamycin B diethylamide
TL;DR: 25-DA-rifamycin B diethylamide (CAS 20501-32-0) is a chemical compound with molecular formula C41H56N2O12 and molecular weight 768.38 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
N,N-diethyl-2-[[(9E,19E,21E)-2,13,15,17,29-pentahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-27-yl]oxy]acetamide
Also Known As: 25-DA-rifamycin B diethylamide
| Molecular Formula | C41H56N2O12 |
|---|---|
| Molecular Weight | 768.38 g/mol |
| LogP | 4.72492 |
| Topological Polar Surface Area | 204.55 Ų |
| Hydrogen Bond Donors | 6 |
| Hydrogen Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Exact Mass | 768.3833 |
| Heavy Atoms | 55 |
| Complexity | 1867.3276 |
Chemical Identifiers
| CAS Number | 20501-32-0 |
|---|---|
| SMILES | CCN(CC)C(=O)COC1=C2C3=C(C(=C1)NC(=O)/C(=C/C=C/C(C(C(C(C(C(C(C(/C=C/OC4(C(=O)C2=C(O4)C(=C3O)C)C)OC)C)O)C)O)C)O)C)/C)O |
Product Overview
25-DA-rifamycin B diethylamide (CAS 20501-32-0), with molecular formula C41H56N2O12 and molecular weight 768.38 g/mol. IUPAC: N,N-diethyl-2-[[(9E,19E,21E)-2,13,15,17,29-pentahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-27-yl]oxy]acetamide.
Chemical Property Profile of 25-DA-rifamycin B diethylamide
Property Insights of 25-DA-rifamycin B diethylamide
The XLogP value of 4.72492 indicates that 25-DA-rifamycin B diethylamide is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 204.55 Ų indicates high polarity, suggesting 25-DA-rifamycin B diethylamide may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, 25-DA-rifamycin B diethylamide has 6 hydrogen bond donor(s) and 12 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of 25-DA-rifamycin B diethylamide?
The CAS number of 25-DA-rifamycin B diethylamide is 20501-32-0.
What is the molecular formula of 25-DA-rifamycin B diethylamide?
The molecular formula of 25-DA-rifamycin B diethylamide is C41H56N2O12.
What is the molecular weight of 25-DA-rifamycin B diethylamide?
The molecular weight of 25-DA-rifamycin B diethylamide is 768.38 g/mol.
Where can I buy 25-DA-rifamycin B diethylamide?
You can request a quote for 25-DA-rifamycin B diethylamide directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for 25-DA-rifamycin B diethylamide?
Yes, KEHONG BIO provides custom synthesis services for 25-DA-rifamycin B diethylamide and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.