Rifamycin B dimethylpropylhydrazide
TL;DR: Rifamycin B dimethylpropylhydrazide (CAS 17607-49-7) is a chemical compound with molecular formula C44H61N3O13 and molecular weight 839.42 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
[(7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z)-27-[2-[dimethylamino(propyl)amino]-2-oxoethoxy]-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-13-yl] acetate
Also Known As: Rifamycin B dimethylpropylhydrazide, NCI 144-131, Rifamycin B, 2,2-dimethyl-1-propylhydrazide, Rifamycin, 4-O-(2-(2,2-dimethyl-1-propylhydrazino)-2-oxoethyl)-, Rifamycin, 4-O-[2-(2,2-dimethyl-1-propylhydrazino)-2-oxoethyl]-
| Molecular Formula | C44H61N3O13 |
|---|---|
| Molecular Weight | 839.42 g/mol |
| LogP | 5.14252 |
| Topological Polar Surface Area | 213.86 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Exact Mass | 839.4204 |
| Heavy Atoms | 60 |
| Complexity | 2044.5183 |
Chemical Identifiers
| CAS Number | 17607-49-7 |
|---|---|
| SMILES | CCCN(C(=O)COC1=C2C3=C(C(=C1)NC(=O)/C(=C\C=C\[C@@H]([C@@H]([C@H]([C@H]([C@H]([C@@H]([C@@H]([C@H](/C=C/O[C@@]4(C(=O)C2=C(O4)C(=C3O)C)C)OC)C)OC(=O)C)C)O)C)O)C)/C)O)N(C)C |
Product Overview
Rifamycin B dimethylpropylhydrazide (CAS 17607-49-7), with molecular formula C44H61N3O13 and molecular weight 839.42 g/mol. IUPAC: [(7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z)-27-[2-[dimethylamino(propyl)amino]-2-oxoethoxy]-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-13-yl] acetate.
Chemical Property Profile of Rifamycin B dimethylpropylhydrazide
Property Insights of Rifamycin B dimethylpropylhydrazide
The XLogP value of 5.14252 indicates that Rifamycin B dimethylpropylhydrazide is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 213.86 Ų indicates high polarity, suggesting Rifamycin B dimethylpropylhydrazide may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Rifamycin B dimethylpropylhydrazide has 5 hydrogen bond donor(s) and 14 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Rifamycin B dimethylpropylhydrazide?
The CAS number of Rifamycin B dimethylpropylhydrazide is 17607-49-7.
What is the molecular formula of Rifamycin B dimethylpropylhydrazide?
The molecular formula of Rifamycin B dimethylpropylhydrazide is C44H61N3O13.
What is the molecular weight of Rifamycin B dimethylpropylhydrazide?
The molecular weight of Rifamycin B dimethylpropylhydrazide is 839.42 g/mol.
Where can I buy Rifamycin B dimethylpropylhydrazide?
You can request a quote for Rifamycin B dimethylpropylhydrazide directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Rifamycin B dimethylpropylhydrazide?
Yes, KEHONG BIO provides custom synthesis services for Rifamycin B dimethylpropylhydrazide and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.