Rifamycin B butyldimethylhydrazide
TL;DR: Rifamycin B butyldimethylhydrazide (CAS 17607-47-5) is a chemical compound with molecular formula C45H63N3O13 and molecular weight 853.44 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
[(7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z)-27-[2-[butyl(dimethylamino)amino]-2-oxoethoxy]-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-13-yl] acetate
Also Known As: Rifamycin B butyldimethylhydrazide, NCI 145-606, Rifamycin B, 1-butyl-2,2-dimethylhydrazide, Rifamycin, 4-O-(2-(1-butyl-2,2-dimethylhydrazino)-2-oxoethyl)-, Rifamycin, 4-O-[2-(1-butyl-2,2-dimethylhydrazino)-2-oxoethyl]-
| Molecular Formula | C45H63N3O13 |
|---|---|
| Molecular Weight | 853.44 g/mol |
| LogP | 5.53262 |
| Topological Polar Surface Area | 213.86 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Exact Mass | 853.4361 |
| Heavy Atoms | 61 |
| Complexity | 2062.1892 |
Chemical Identifiers
| CAS Number | 17607-47-5 |
|---|---|
| SMILES | CCCCN(C(=O)COC1=C2C3=C(C(=C1)NC(=O)/C(=C\C=C\[C@@H]([C@@H]([C@H]([C@H]([C@H]([C@@H]([C@@H]([C@H](/C=C/O[C@@]4(C(=O)C2=C(O4)C(=C3O)C)C)OC)C)OC(=O)C)C)O)C)O)C)/C)O)N(C)C |
Product Overview
Rifamycin B butyldimethylhydrazide (CAS 17607-47-5), with molecular formula C45H63N3O13 and molecular weight 853.44 g/mol. IUPAC: [(7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z)-27-[2-[butyl(dimethylamino)amino]-2-oxoethoxy]-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-13-yl] acetate.
Chemical Property Profile of Rifamycin B butyldimethylhydrazide
Property Insights of Rifamycin B butyldimethylhydrazide
The XLogP value of 5.53262 indicates that Rifamycin B butyldimethylhydrazide is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 213.86 Ų indicates high polarity, suggesting Rifamycin B butyldimethylhydrazide may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Rifamycin B butyldimethylhydrazide has 5 hydrogen bond donor(s) and 14 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Rifamycin B butyldimethylhydrazide?
The CAS number of Rifamycin B butyldimethylhydrazide is 17607-47-5.
What is the molecular formula of Rifamycin B butyldimethylhydrazide?
The molecular formula of Rifamycin B butyldimethylhydrazide is C45H63N3O13.
What is the molecular weight of Rifamycin B butyldimethylhydrazide?
The molecular weight of Rifamycin B butyldimethylhydrazide is 853.44 g/mol.
Where can I buy Rifamycin B butyldimethylhydrazide?
You can request a quote for Rifamycin B butyldimethylhydrazide directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Rifamycin B butyldimethylhydrazide?
Yes, KEHONG BIO provides custom synthesis services for Rifamycin B butyldimethylhydrazide and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.