Rifamycin B diallylamide
TL;DR: Rifamycin B diallylamide (CAS 17607-45-3) is a chemical compound with molecular formula C45H58N2O13 and molecular weight 834.39 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
[27-[2-[bis(prop-2-enyl)amino]-2-oxoethoxy]-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-13-yl] acetate
Also Known As: Rifamycin B diallylamide, Acetamide,{2-[[1,2-dihydro-5,6,17,19,21-pentahydroxy-23-methoxy-2,}{4,12,16,18,20,22-heptamethyl-1,11-dioxo-2,7-(epoxypentadeca[1,11,}{13]trienimino)naphtho[2,1-b]furan-9-yl]oxy]-N,N-diallyl-,}21-acet
| Molecular Formula | C45H58N2O13 |
|---|---|
| Molecular Weight | 834.39 g/mol |
| LogP | 6.0 |
| Topological Polar Surface Area | 211.0 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Exact Mass | 834.39386 |
| Heavy Atoms | 60 |
| Complexity | 1640.0 |
Chemical Identifiers
| CAS Number | 17607-45-3 |
|---|---|
| SMILES | CC1C=CC=C(C(=O)NC2=CC(=C3C(=C2O)C(=C(C4=C3C(=O)C(O4)(OC=CC(C(C(C(C(C(C1O)C)O)C)OC(=O)C)C)OC)C)C)O)OCC(=O)N(CC=C)CC=C)C |
| InChIKey | MHTJOVRCLPHPDE-UHFFFAOYSA-N |
Product Overview
Rifamycin B diallylamide (CAS 17607-45-3), with molecular formula C45H58N2O13 and molecular weight 834.39 g/mol. IUPAC: [27-[2-[bis(prop-2-enyl)amino]-2-oxoethoxy]-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-13-yl] acetate.
Chemical Property Profile of Rifamycin B diallylamide
Property Insights of Rifamycin B diallylamide
The XLogP value of 6.0 indicates that Rifamycin B diallylamide is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 211.0 Ų indicates high polarity, suggesting Rifamycin B diallylamide may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Rifamycin B diallylamide has 5 hydrogen bond donor(s) and 13 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Rifamycin B diallylamide?
The CAS number of Rifamycin B diallylamide is 17607-45-3.
What is the molecular formula of Rifamycin B diallylamide?
The molecular formula of Rifamycin B diallylamide is C45H58N2O13.
What is the molecular weight of Rifamycin B diallylamide?
The molecular weight of Rifamycin B diallylamide is 834.39 g/mol.
Where can I buy Rifamycin B diallylamide?
You can request a quote for Rifamycin B diallylamide directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Rifamycin B diallylamide?
Yes, KEHONG BIO provides custom synthesis services for Rifamycin B diallylamide and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.