KY-62 amphotericin B analog
TL;DR: KY-62 amphotericin B analog (CAS 164265-45-6) is a chemical compound with molecular formula C60H100N2O22 and molecular weight 1200.68 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
(1R,3S,5S,8S,9S,11R,15S,16S,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-1,3,5,8,9,11,17,37-octahydroxy-N-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxamide
Also Known As: KY-62 amphotericin B analog, Leishmaniasis therapy, University of Texas, (1S,3R,4E,6E,8E,10E,12E,14E,16E,18S,19R,20S,21S,25R,27S,28S,31S,33S,35R,37S,38R)-3-[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyl-tetrahydropyran-2-yl]oxy-19,25,27,28,31,33,35,37-octahydroxy-N-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-18,20,21-trimethyl-23-oxo-22,39-dioxabicyclo[33.3.1]nonatriaconta-4,6,8,10,12,14,16-heptaene-38-carboxamide, (1S,3R,4E,6E,8E,10E,12E,14E,16E,18S,19R,20S,21S,25R,27S,28S,31S,33S,35R,37S,38R)-3-[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-19,25,27,28,31,33,35,37-octahydroxy-N-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-18,20,21-trimethyl-23-oxo-22,39-dioxabicyclo[33.3.1]nonatriaconta-4,6,8,10,12,14,16-heptaene-38-carboxamide
| Molecular Formula | C60H100N2O22 |
|---|---|
| Molecular Weight | 1200.68 g/mol |
| LogP | 0.4727 |
| Topological Polar Surface Area | 366.79 Ų |
| Hydrogen Bond Donors | 12 |
| Hydrogen Bond Acceptors | 23 |
| Rotatable Bonds | 21 |
| Exact Mass | 1200.6768 |
| Heavy Atoms | 84 |
| Complexity | 2008.3865 |
Chemical Identifiers
| CAS Number | 164265-45-6 |
|---|---|
| SMILES | C[C@H]1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@@H](C[C@H]2[C@@H]([C@H](C[C@](O2)(C[C@H](C[C@H](CC[C@@H]([C@H](C[C@H](CC(=O)O[C@H]([C@H]([C@@H]1O)C)C)O)O)O)O)O)O)O)C(=O)NCCOCCOCCOCCOCCOCCOC)O[C@H]3[C@H]([C@H]([C@@H]([C@H](O3)C)O)N)O |
Product Overview
KY-62 amphotericin B analog (CAS 164265-45-6), with molecular formula C60H100N2O22 and molecular weight 1200.68 g/mol. IUPAC: (1R,3S,5S,8S,9S,11R,15S,16S,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-1,3,5,8,9,11,17,37-octahydroxy-N-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxamide.
Chemical Property Profile of KY-62 amphotericin B analog
Property Insights of KY-62 amphotericin B analog
The XLogP value of 0.4727 suggests moderate lipophilicity, balancing water solubility and membrane permeability for KY-62 amphotericin B analog. The TPSA of 366.79 Ų indicates high polarity, suggesting KY-62 amphotericin B analog may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, KY-62 amphotericin B analog has 12 hydrogen bond donor(s) and 23 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of KY-62 amphotericin B analog?
The CAS number of KY-62 amphotericin B analog is 164265-45-6.
What is the molecular formula of KY-62 amphotericin B analog?
The molecular formula of KY-62 amphotericin B analog is C60H100N2O22.
What is the molecular weight of KY-62 amphotericin B analog?
The molecular weight of KY-62 amphotericin B analog is 1200.68 g/mol.
Where can I buy KY-62 amphotericin B analog?
You can request a quote for KY-62 amphotericin B analog directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for KY-62 amphotericin B analog?
Yes, KEHONG BIO provides custom synthesis services for KY-62 amphotericin B analog and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.