Ferrioxamine B
TL;DR: Ferrioxamine B (CAS 15074-61-0) is a chemical compound with molecular formula C25H45FeN6O8 and molecular weight 613.26 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
N-[5-[[4-[5-[acetyl(oxido)amino]pentylamino]-4-oxobutanoyl]-oxidoamino]pentyl]-N'-(5-aminopentyl)-N'-oxidobutanediamide;iron(3+)
Also Known As: ferrioxamine B, Ferrioxamine, Ferroxamine, Desferal-iron(III), FERRIOXAMINE D
| Molecular Formula | C25H45FeN6O8 |
|---|---|
| Molecular Weight | 613.26 g/mol |
| LogP | 1.2454 |
| Topological Polar Surface Area | 214.0 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Exact Mass | 613.26483 |
| Heavy Atoms | 40 |
| Complexity | 739.0 |
Chemical Identifiers
| CAS Number | 15074-61-0 |
|---|---|
| SMILES | CC(=O)N(CCCCCNC(=O)CCC(=O)N(CCCCCNC(=O)CCC(=O)N(CCCCCN)[O-])[O-])[O-].[Fe+3] |
| InChIKey | SRMBQCVUAVULDJ-UHFFFAOYSA-N |
Product Overview
Ferrioxamine B (CAS 15074-61-0), with molecular formula C25H45FeN6O8 and molecular weight 613.26 g/mol. IUPAC: N-[5-[[4-[5-[acetyl(oxido)amino]pentylamino]-4-oxobutanoyl]-oxidoamino]pentyl]-N'-(5-aminopentyl)-N'-oxidobutanediamide;iron(3+).
Chemical Property Profile of Ferrioxamine B
Property Insights of Ferrioxamine B
The XLogP value of 1.2454 suggests moderate lipophilicity, balancing water solubility and membrane permeability for Ferrioxamine B. The TPSA of 214.0 Ų indicates high polarity, suggesting Ferrioxamine B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Ferrioxamine B has 3 hydrogen bond donor(s) and 9 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Ferrioxamine B?
The CAS number of Ferrioxamine B is 15074-61-0.
What is the molecular formula of Ferrioxamine B?
The molecular formula of Ferrioxamine B is C25H45FeN6O8.
What is the molecular weight of Ferrioxamine B?
The molecular weight of Ferrioxamine B is 613.26 g/mol.
Where can I buy Ferrioxamine B?
You can request a quote for Ferrioxamine B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Ferrioxamine B?
Yes, KEHONG BIO provides custom synthesis services for Ferrioxamine B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.