Chloramine B
TL;DR: Chloramine B (CAS 149358-72-5) is a chemical compound with molecular formula C6H5ClNNaO2S and molecular weight 212.96 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
sodium benzenesulfonyl(chloro)azanide
Also Known As: CHLORAMINE B, Chloramine-B, Neomagnol, Chlordetal, Annogen
| Molecular Formula | C6H5ClNNaO2S |
|---|---|
| Molecular Weight | 212.96 g/mol |
| LogP | -1.0932 |
| Topological Polar Surface Area | 48.24 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 212.96272 |
| Heavy Atoms | 12 |
| Complexity | 326.66113 |
Chemical Identifiers
| CAS Number | 149358-72-5 |
|---|---|
| SMILES | C1=CC=C(C=C1)S(=O)(=O)[N-]Cl.[Na+] |
Product Overview
Chloramine B (CAS 149358-72-5), with molecular formula C6H5ClNNaO2S and molecular weight 212.96 g/mol. IUPAC: sodium benzenesulfonyl(chloro)azanide.
Chemical Property Profile of Chloramine B
Property Insights of Chloramine B
The XLogP value of -1.0932 indicates that Chloramine B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. With a topological polar surface area (TPSA) of 48.24 Ų, Chloramine B exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, Chloramine B has 0 hydrogen bond donor(s) and 2 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Chloramine B?
The CAS number of Chloramine B is 149358-72-5.
What is the molecular formula of Chloramine B?
The molecular formula of Chloramine B is C6H5ClNNaO2S.
What is the molecular weight of Chloramine B?
The molecular weight of Chloramine B is 212.96 g/mol.
Where can I buy Chloramine B?
You can request a quote for Chloramine B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Chloramine B?
Yes, KEHONG BIO provides custom synthesis services for Chloramine B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.