factor III, vitamin B 12
TL;DR: factor III, vitamin B 12 (CAS 14708-95-3) is a chemical compound with molecular formula C61H84CoN14O15P and molecular weight 1342.53 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
cobalt(3+);[4-hydroxy-5-(5-hydroxybenzimidazol-1-yl)-2-(hydroxymethyl)oxolan-3-yl] 1-[3-[(4Z,9Z,14Z)-2,13,18-tris(2-amino-2-oxoethyl)-7,12,17-tris(3-amino-3-oxopropyl)-3,5,8,8,13,15,18,19-octamethyl-2,7,12,17-tetrahydro-1H-corrin-21-id-3-yl]propanoylamino]propan-2-yl phosphate;cyanide
Also Known As: HMQC, Factor III, corrinoid, Factor III, vitamin B 12, 5-Hydroxybenzimidazolylcobamid, 5-Hydroxybenzimidazolylcobamide
| Molecular Formula | C61H84CoN14O15P |
|---|---|
| Molecular Weight | 1342.53 g/mol |
| LogP | 2.49797 |
| Topological Polar Surface Area | 508.94 Ų |
| Hydrogen Bond Donors | 10 |
| Hydrogen Bond Acceptors | 20 |
| Rotatable Bonds | 26 |
| Exact Mass | 1342.531 |
| Heavy Atoms | 92 |
| Complexity | 3546.0288 |
Chemical Identifiers
| CAS Number | 14708-95-3 |
|---|---|
| SMILES | C/C/1=C/2\C(C(C([N-]2)C3(C(C(C(=N3)/C(=C\4/C(C(C(=N4)/C=C\5/C(C(C1=N5)CCC(=O)N)(C)C)CCC(=O)N)(C)CC(=O)N)/C)CCC(=O)N)(C)CC(=O)N)C)CC(=O)N)(C)CCC(=O)NCC(C)OP(=O)([O-])OC6C(OC(C6O)N7C=NC8=C7C=CC(=C8)O)CO.[C-]#N.[Co+3] |
Product Overview
factor III, vitamin B 12 (CAS 14708-95-3), with molecular formula C61H84CoN14O15P and molecular weight 1342.53 g/mol. IUPAC: cobalt(3+);[4-hydroxy-5-(5-hydroxybenzimidazol-1-yl)-2-(hydroxymethyl)oxolan-3-yl] 1-[3-[(4Z,9Z,14Z)-2,13,18-tris(2-amino-2-oxoethyl)-7,12,17-tris(3-amino-3-oxopropyl)-3,5,8,8,13,15,18,19-octamethyl-2,7,12,17-tetrahydro-1H-corrin-21-id-3-yl]propanoylamino]propan-2-yl phosphate;cyanide.
Chemical Property Profile of factor III, vitamin B 12
Property Insights of factor III, vitamin B 12
The XLogP value of 2.49797 suggests moderate lipophilicity, balancing water solubility and membrane permeability for factor III, vitamin B 12. The TPSA of 508.94 Ų indicates high polarity, suggesting factor III, vitamin B 12 may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, factor III, vitamin B 12 has 10 hydrogen bond donor(s) and 20 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of factor III, vitamin B 12?
The CAS number of factor III, vitamin B 12 is 14708-95-3.
What is the molecular formula of factor III, vitamin B 12?
The molecular formula of factor III, vitamin B 12 is C61H84CoN14O15P.
What is the molecular weight of factor III, vitamin B 12?
The molecular weight of factor III, vitamin B 12 is 1342.53 g/mol.
Where can I buy factor III, vitamin B 12?
You can request a quote for factor III, vitamin B 12 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for factor III, vitamin B 12?
Yes, KEHONG BIO provides custom synthesis services for factor III, vitamin B 12 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.