Rifamycin B anilide
TL;DR: Rifamycin B anilide (CAS 13929-39-0) is a chemical compound with molecular formula C45H54N2O13 and molecular weight 830.36 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
[(9E,19E,21E)-27-(2-anilino-2-oxoethoxy)-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-13-yl] acetate
Also Known As: Rifamycin B anilide, Rifamycin B phenylamide, 4-O-[2-Oxo-2-(phenylamino)ethyl]rifamycin, Rifamycin, 4-O-(2-oxo-2-(phenylamino)ethyl)-, Rifamycin, 4-O-[2-oxo-2-(phenylamino)ethyl]-
| Molecular Formula | C45H54N2O13 |
|---|---|
| Molecular Weight | 830.36 g/mol |
| LogP | 6.06602 |
| Topological Polar Surface Area | 219.41 Ų |
| Hydrogen Bond Donors | 6 |
| Hydrogen Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Exact Mass | 830.3626 |
| Heavy Atoms | 60 |
| Complexity | 2217.3984 |
Chemical Identifiers
| CAS Number | 13929-39-0 |
|---|---|
| SMILES | CC1/C=C/C=C(/C(=O)NC2=CC(=C3C(=C2O)C(=C(C4=C3C(=O)C(O4)(O/C=C/C(C(C(C(C(C(C1O)C)O)C)OC(=O)C)C)OC)C)C)O)OCC(=O)NC5=CC=CC=C5)\C |
Product Overview
Rifamycin B anilide (CAS 13929-39-0), with molecular formula C45H54N2O13 and molecular weight 830.36 g/mol. IUPAC: [(9E,19E,21E)-27-(2-anilino-2-oxoethoxy)-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-13-yl] acetate.
Chemical Property Profile of Rifamycin B anilide
Property Insights of Rifamycin B anilide
The XLogP value of 6.06602 indicates that Rifamycin B anilide is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 219.41 Ų indicates high polarity, suggesting Rifamycin B anilide may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Rifamycin B anilide has 6 hydrogen bond donor(s) and 13 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Rifamycin B anilide?
The CAS number of Rifamycin B anilide is 13929-39-0.
What is the molecular formula of Rifamycin B anilide?
The molecular formula of Rifamycin B anilide is C45H54N2O13.
What is the molecular weight of Rifamycin B anilide?
The molecular weight of Rifamycin B anilide is 830.36 g/mol.
Where can I buy Rifamycin B anilide?
You can request a quote for Rifamycin B anilide directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Rifamycin B anilide?
Yes, KEHONG BIO provides custom synthesis services for Rifamycin B anilide and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.