B 1525
TL;DR: B 1525 (CAS 136996-82-2) is a chemical compound with molecular formula C22H34ClN3O3S and molecular weight 455.20 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
1-[(4-methyl-1,3-thiazol-5-yl)oxy]-3-[4-(2-pentoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride
Also Known As: B 1525, 1-Piperazineethanol, alpha-(((4-methyl-5-thiazolyl)oxy)methyl)-4-(2-(pentyloxy)phenyl)-, monohydrochloride, 3-(4-o-Pentoxyphenylpiperazin-1-yl)-1-(4-methylthiazolyl-5-oxy)propan-2-ol hydrochloride, 1-[(4-methyl-1,3-thiazol-5-yl)oxy]-3-[4-(2-pentoxyphenyl)piperazin-1-yl]propan-2-ol hydrochloride, 1-[(4-Methyl-1,3-thiazol-5-yl)oxy]-3-{4-[2-(pentyloxy)phenyl]piperazin-1-yl}propan-2-ol--hydrogen chloride (1/1)
| Molecular Formula | C22H34ClN3O3S |
|---|---|
| Molecular Weight | 455.20 g/mol |
| LogP | 4.00422 |
| Topological Polar Surface Area | 58.06 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Exact Mass | 455.20093 |
| Heavy Atoms | 30 |
| Complexity | 737.9228 |
Chemical Identifiers
| CAS Number | 136996-82-2 |
|---|---|
| SMILES | CCCCCOC1=CC=CC=C1N2CCN(CC2)CC(COC3=C(N=CS3)C)O.Cl |
Product Overview
B 1525 (CAS 136996-82-2), with molecular formula C22H34ClN3O3S and molecular weight 455.20 g/mol. IUPAC: 1-[(4-methyl-1,3-thiazol-5-yl)oxy]-3-[4-(2-pentoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride.
Chemical Property Profile of B 1525
Property Insights of B 1525
The XLogP value of 4.00422 indicates that B 1525 is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 58.06 Ų, B 1525 exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, B 1525 has 1 hydrogen bond donor(s) and 7 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 1525?
The CAS number of B 1525 is 136996-82-2.
What is the molecular formula of B 1525?
The molecular formula of B 1525 is C22H34ClN3O3S.
What is the molecular weight of B 1525?
The molecular weight of B 1525 is 455.20 g/mol.
Where can I buy B 1525?
You can request a quote for B 1525 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 1525?
Yes, KEHONG BIO provides custom synthesis services for B 1525 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.