B 1430
TL;DR: B 1430 (CAS 136996-53-7) is a chemical compound with molecular formula C16H21N3O2S and molecular weight 319.14 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
2-[4-[2-[(4-methyl-1,3-thiazol-5-yl)oxy]ethyl]piperazin-1-yl]phenol
Also Known As: B 1430, 4-Methyl-5-(2-(4-o-hydroxyphenylpiperazin-1-yl)ethoxy)thiazole hydrochloride, 2-(4-(2-((4-Methyl-5-thiazolyl)oxy)ethyl)-1-piperazinyl)phenol monohydrochloride, Phenol, 2-(4-(2-((4-methyl-5-thiazolyl)oxy)ethyl)-1-piperazinyl)-, monohydrochloride, 2-(4-{2-[(4-Methyl-1,3-thiazol-5-yl)oxy]ethyl}piperazin-1-yl)phenol
| Molecular Formula | C16H21N3O2S |
|---|---|
| Molecular Weight | 319.14 g/mol |
| LogP | 2.35812 |
| Topological Polar Surface Area | 48.83 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Exact Mass | 319.13544 |
| Heavy Atoms | 22 |
| Complexity | 608.9433 |
Chemical Identifiers
| CAS Number | 136996-53-7 |
|---|---|
| SMILES | CC1=C(SC=N1)OCCN2CCN(CC2)C3=CC=CC=C3O |
Product Overview
B 1430 (CAS 136996-53-7), with molecular formula C16H21N3O2S and molecular weight 319.14 g/mol. IUPAC: 2-[4-[2-[(4-methyl-1,3-thiazol-5-yl)oxy]ethyl]piperazin-1-yl]phenol.
Chemical Property Profile of B 1430
Property Insights of B 1430
The XLogP value of 2.35812 suggests moderate lipophilicity, balancing water solubility and membrane permeability for B 1430. With a topological polar surface area (TPSA) of 48.83 Ų, B 1430 exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, B 1430 has 1 hydrogen bond donor(s) and 6 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 1430?
The CAS number of B 1430 is 136996-53-7.
What is the molecular formula of B 1430?
The molecular formula of B 1430 is C16H21N3O2S.
What is the molecular weight of B 1430?
The molecular weight of B 1430 is 319.14 g/mol.
Where can I buy B 1430?
You can request a quote for B 1430 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 1430?
Yes, KEHONG BIO provides custom synthesis services for B 1430 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.