B 85-0040
TL;DR: B 85-0040 (CAS 13304-50-2) is a chemical compound with molecular formula C12H22N2O5Pt and molecular weight 469.12 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
cyclobutane-1,1-dicarboxylate;2-(methoxymethyl)-2-methylpropane-1,3-diamine;platinum(2+)
Also Known As: cyclobutane-1,1-dicarboxylate, B 85-0040, B-85-0040, Platinum,[1,1-cyclobutanedi(carboxylato-kO)(2-)][2-(methoxymethyl)-2-methyl-1,3-propanediamine-kN,kN']-, (SP-4-2)- (9CI), cyclobutane-1,1-dicarboxylate,2-(methoxymethyl)-2-methylpropane-1,3-diamine,platinum(2+)
| Molecular Formula | C12H22N2O5Pt |
|---|---|
| Molecular Weight | 469.12 g/mol |
| LogP | -2.7895 |
| Topological Polar Surface Area | 142.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Exact Mass | 469.11768 |
| Heavy Atoms | 20 |
| Complexity | 225.0 |
Chemical Identifiers
| CAS Number | 13304-50-2 |
|---|---|
| SMILES | CC(CN)(CN)COC.C1CC(C1)(C(=O)[O-])C(=O)[O-].[Pt+2] |
| InChIKey | FDEIZJZPVPINRB-UHFFFAOYSA-L |
Product Overview
B 85-0040 (CAS 13304-50-2), with molecular formula C12H22N2O5Pt and molecular weight 469.12 g/mol. IUPAC: cyclobutane-1,1-dicarboxylate;2-(methoxymethyl)-2-methylpropane-1,3-diamine;platinum(2+).
Chemical Property Profile of B 85-0040
Property Insights of B 85-0040
The XLogP value of -2.7895 indicates that B 85-0040 is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 142.0 Ų indicates high polarity, suggesting B 85-0040 may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, B 85-0040 has 2 hydrogen bond donor(s) and 7 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 85-0040?
The CAS number of B 85-0040 is 13304-50-2.
What is the molecular formula of B 85-0040?
The molecular formula of B 85-0040 is C12H22N2O5Pt.
What is the molecular weight of B 85-0040?
The molecular weight of B 85-0040 is 469.12 g/mol.
Where can I buy B 85-0040?
You can request a quote for B 85-0040 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 85-0040?
Yes, KEHONG BIO provides custom synthesis services for B 85-0040 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.