Dynorphin B (5-9)
TL;DR: Dynorphin B (5-9) (CAS 132733-02-9) is a chemical compound with molecular formula C32H54N12O7 and molecular weight 718.42 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
(2S)-2-[[(2S)-5-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-phenylpropanoic acid
Also Known As: LRRQF, Dynorphin B (5-9), 2DEOXYDGLUCOPYRANOSE3,4,6TRIBENZYLETHER, L-Phenylalanine, N-(N2-(N2-(N2-L-leucyl-L-arginyl)-L-arginyl)-L-glutaminyl)-, L-Leucyl-L-arginyl-L-arginyl-L-glutaminyl-L-phenylalanine
| Molecular Formula | C32H54N12O7 |
|---|---|
| Molecular Weight | 718.42 g/mol |
| LogP | -3.001 |
| Topological Polar Surface Area | 351.61 Ų |
| Hydrogen Bond Donors | 11 |
| Hydrogen Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Exact Mass | 718.4238 |
| Heavy Atoms | 51 |
| Complexity | 1365.363 |
Chemical Identifiers
| CAS Number | 132733-02-9 |
|---|---|
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)N |
Product Overview
Dynorphin B (5-9) (CAS 132733-02-9), with molecular formula C32H54N12O7 and molecular weight 718.42 g/mol. IUPAC: (2S)-2-[[(2S)-5-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-phenylpropanoic acid.
Chemical Property Profile of Dynorphin B (5-9)
Property Insights of Dynorphin B (5-9)
The XLogP value of -3.001 indicates that Dynorphin B (5-9) is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 351.61 Ų indicates high polarity, suggesting Dynorphin B (5-9) may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Dynorphin B (5-9) has 11 hydrogen bond donor(s) and 9 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Dynorphin B (5-9)?
The CAS number of Dynorphin B (5-9) is 132733-02-9.
What is the molecular formula of Dynorphin B (5-9)?
The molecular formula of Dynorphin B (5-9) is C32H54N12O7.
What is the molecular weight of Dynorphin B (5-9)?
The molecular weight of Dynorphin B (5-9) is 718.42 g/mol.
Where can I buy Dynorphin B (5-9)?
You can request a quote for Dynorphin B (5-9) directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Dynorphin B (5-9)?
Yes, KEHONG BIO provides custom synthesis services for Dynorphin B (5-9) and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.