Amphotericin B O-methyloxime
TL;DR: Amphotericin B O-methyloxime (CAS 132202-02-9) is a chemical compound with molecular formula C48H76N2O17 and molecular weight 952.51 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
(14Z,21E,23E,25E,27E,29E,31E,33E)-20-(4-amino-3,5-dihydroxy-6-methyloxan-2-yl)oxy-4,6,9,10,12,16,18,36-octahydroxy-14-methoxyimino-35,37,38-trimethyl-2-oxo-1-oxacyclooctatriaconta-21,23,25,27,29,31,33-heptaene-17-carboxylic acid
Also Known As: Amphotericin B O-methyloxime, Amphotericin B, 13,17-deepoxy-13-deoxy-17-hydroxy-13-(methoxyimino)-, (13E)-, (14Z,21E,23E,25E,27E,29E,31E,33E)-20-(4-amino-3,5-dihydroxy-6-methyloxan-2-yl)oxy-4,6,9,10,12,16,18,36-octahydroxy-14-methoxyimino-35,37,38-trimethyl-2-oxo-1-oxacyclooctatriaconta-21,23,25,27,29,31,33-heptaene-17-carboxylic acid
| Molecular Formula | C48H76N2O17 |
|---|---|
| Molecular Weight | 952.51 g/mol |
| LogP | 0.9876 |
| Topological Polar Surface Area | 331.97 Ų |
| Hydrogen Bond Donors | 12 |
| Hydrogen Bond Acceptors | 18 |
| Rotatable Bonds | 4 |
| Exact Mass | 952.5144 |
| Heavy Atoms | 67 |
| Complexity | 1699.2278 |
Chemical Identifiers
| CAS Number | 132202-02-9 |
|---|---|
| SMILES | CC1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(CC(C(C(C/C(=N\OC)/CC(CC(C(CCC(CC(CC(=O)OC(C(C1O)C)C)O)O)O)O)O)O)C(=O)O)O)OC2C(C(C(C(O2)C)O)N)O |
Product Overview
Amphotericin B O-methyloxime (CAS 132202-02-9), with molecular formula C48H76N2O17 and molecular weight 952.51 g/mol. IUPAC: (14Z,21E,23E,25E,27E,29E,31E,33E)-20-(4-amino-3,5-dihydroxy-6-methyloxan-2-yl)oxy-4,6,9,10,12,16,18,36-octahydroxy-14-methoxyimino-35,37,38-trimethyl-2-oxo-1-oxacyclooctatriaconta-21,23,25,27,29,31,33-heptaene-17-carboxylic acid.
Chemical Property Profile of Amphotericin B O-methyloxime
Property Insights of Amphotericin B O-methyloxime
The XLogP value of 0.9876 suggests moderate lipophilicity, balancing water solubility and membrane permeability for Amphotericin B O-methyloxime. The TPSA of 331.97 Ų indicates high polarity, suggesting Amphotericin B O-methyloxime may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Amphotericin B O-methyloxime has 12 hydrogen bond donor(s) and 18 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Amphotericin B O-methyloxime?
The CAS number of Amphotericin B O-methyloxime is 132202-02-9.
What is the molecular formula of Amphotericin B O-methyloxime?
The molecular formula of Amphotericin B O-methyloxime is C48H76N2O17.
What is the molecular weight of Amphotericin B O-methyloxime?
The molecular weight of Amphotericin B O-methyloxime is 952.51 g/mol.
Where can I buy Amphotericin B O-methyloxime?
You can request a quote for Amphotericin B O-methyloxime directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Amphotericin B O-methyloxime?
Yes, KEHONG BIO provides custom synthesis services for Amphotericin B O-methyloxime and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.