Amphoteronolide B
TL;DR: Amphoteronolide B (CAS 106799-07-9) is a chemical compound with molecular formula C41H62O14 and molecular weight 778.41 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
(1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,33R,35S,36R,37S)-1,3,5,6,9,11,17,33,37-nonahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid
Also Known As: Amphoteronolide B, Amphotericin B aglycone, Amphoteronolide B (>80%), J3.703.253K, (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,33R,35S,36R,37S)-1,3,5,6,9,11,17,33,37-nonahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid
| Molecular Formula | C41H62O14 |
|---|---|
| Molecular Weight | 778.41 g/mol |
| LogP | 3.6 |
| Topological Polar Surface Area | 255.0 Ų |
| Hydrogen Bond Donors | 10 |
| Hydrogen Bond Acceptors | 14 |
| Rotatable Bonds | 1 |
| Exact Mass | 778.41394 |
| Heavy Atoms | 55 |
| Complexity | 1370.0 |
Chemical Identifiers
| CAS Number | 106799-07-9 |
|---|---|
| SMILES | C[C@H]1C=CC=CC=CC=CC=CC=CC=C[C@@H](C[C@H]2[C@@H]([C@H](C[C@](O2)(C[C@H](C[C@H]([C@@H](CC[C@H](C[C@H](CC(=O)O[C@H]([C@@H]([C@@H]1O)C)C)O)O)O)O)O)O)O)C(=O)O)O |
| InChIKey | VOPKRGFUUMVSHY-ZQCSYNFZSA-N |
Product Overview
Amphoteronolide B (CAS 106799-07-9), with molecular formula C41H62O14 and molecular weight 778.41 g/mol. IUPAC: (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,33R,35S,36R,37S)-1,3,5,6,9,11,17,33,37-nonahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid.
Chemical Property Profile of Amphoteronolide B
Property Insights of Amphoteronolide B
The XLogP value of 3.6 indicates that Amphoteronolide B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 255.0 Ų indicates high polarity, suggesting Amphoteronolide B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Amphoteronolide B has 10 hydrogen bond donor(s) and 14 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Amphoteronolide B?
The CAS number of Amphoteronolide B is 106799-07-9.
What is the molecular formula of Amphoteronolide B?
The molecular formula of Amphoteronolide B is C41H62O14.
What is the molecular weight of Amphoteronolide B?
The molecular weight of Amphoteronolide B is 778.41 g/mol.
Where can I buy Amphoteronolide B?
You can request a quote for Amphoteronolide B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Amphoteronolide B?
Yes, KEHONG BIO provides custom synthesis services for Amphoteronolide B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.